C20H23N3O4 — CID 70028053
2-[1-[[6-(benzylamino)-3-pyridinyl]-ethylamino]propylidene]propanedioic acid (PubChem CID 70028053) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 2-[1-[[6-(benzylamino)-3-pyridinyl]-ethylamino]propylidene]propanedioic acid.
| Compound Name | 2-[1-[[6-(benzylamino)-3-pyridinyl]-ethylamino]propylidene]propanedioic acid |
|---|---|
| PubChem CID | 70028053 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 2-[1-[[6-(benzylamino)-3-pyridinyl]-ethylamino]propylidene]propanedioic acid |
| SMILES | CCC(=C(C(=O)O)C(=O)O)N(CC)c1ccc(NCc2ccccc2)nc1 |
| InChI | InChI=1S/C20H23N3O4/c1-3-16(18(19(24)25)20(26)27)23(4-2)15-10-11-17(22-13-15)21-12-14-8-6-5-7-9-14/h5-11,13H,3-4,12H2,1-2H3,(H,21,22)(H,24,25)(H,26,27) |
| InChIKey | SODZXNHEQJWVSU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|