C34H32FN5O6 — CID 159277489
6-(benzylamino)pyridine-3-carboxylic acid;methyl 6-(benzylamino)pyridine-3-carboxylate;methyl 6-fluoropyridine-3-carboxylate (PubChem CID 159277489) has the molecular formula C34H32FN5O6 and a molecular weight of 625.66 g/mol. Its IUPAC name is 6-(benzylamino)pyridine-3-carboxylic acid;methyl 6-(benzylamino)pyridine-3-carboxylate;methyl 6-fluoropyridine-3-carboxylate.
| Compound Name | 6-(benzylamino)pyridine-3-carboxylic acid;methyl 6-(benzylamino)pyridine-3-carboxylate;methyl 6-fluoropyridine-3-carboxylate |
|---|---|
| PubChem CID | 159277489 |
| Molecular Formula | C34H32FN5O6 |
| Molecular Weight | 625.66 g/mol |
| Exact Mass | 625.23 |
| IUPAC Name | 6-(benzylamino)pyridine-3-carboxylic acid;methyl 6-(benzylamino)pyridine-3-carboxylate;methyl 6-fluoropyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(F)nc1.COC(=O)c1ccc(NCc2ccccc2)nc1.O=C(O)c1ccc(NCc2ccccc2)nc1 |
| InChI | InChI=1S/C14H14N2O2.C13H12N2O2.C7H6FNO2/c1-18-14(17)12-7-8-13(16-10-12)15-9-11-5-3-2-4-6-11;16-13(17)11-6-7-12(15-9-11)14-8-10-4-2-1-3-5-10;1-11-7(10)5-2-3-6(8)9-4-5/h2-8,10H,9H2,1H3,(H,15,16);1-7,9H,8H2,(H,14,15)(H,16,17);2-4H,1H3 |
| InChIKey | KYMOSOJZXAUGKG-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 152.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.66 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|