C14H25ClN2O3 — CID 70029419
3-(1-acetamido-2-ethylbutyl)-4-aminocyclopentene-1-carboxylic acid;hydrochloride (PubChem CID 70029419) has the molecular formula C14H25ClN2O3 and a molecular weight of 304.82 g/mol. Its IUPAC name is 3-(1-acetamido-2-ethylbutyl)-4-aminocyclopentene-1-carboxylic acid;hydrochloride.
| Compound Name | 3-(1-acetamido-2-ethylbutyl)-4-aminocyclopentene-1-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 70029419 |
| Molecular Formula | C14H25ClN2O3 |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 3-(1-acetamido-2-ethylbutyl)-4-aminocyclopentene-1-carboxylic acid;hydrochloride |
| SMILES | CCC(CC)C(NC(C)=O)C1C=C(C(=O)O)CC1N.Cl |
| InChI | InChI=1S/C14H24N2O3.ClH/c1-4-9(5-2)13(16-8(3)17)11-6-10(14(18)19)7-12(11)15;/h6,9,11-13H,4-5,7,15H2,1-3H3,(H,16,17)(H,18,19);1H |
| InChIKey | HDPIQNUHAKQRDU-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |