C33H51N5O9 — CID 70029538
3-O-tert-butyl 1-O-methyl 2-amino-2-[[4-[[3-[3-carbamimidoyl-4-[(2-methylpropan-2-yl)oxy]-4-oxo-3-piperidin-4-ylbutyl]-2-oxo-1,3-oxazolidin-5-yl]methoxy]phenyl]methyl]propanedioate (PubChem CID 70029538) has the molecular formula C33H51N5O9 and a molecular weight of 661.80 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-methyl 2-amino-2-[[4-[[3-[3-carbamimidoyl-4-[(2-methylpropan-2-yl)oxy]-4-oxo-3-piperidin-4-ylbutyl]-2-oxo-1,3-oxazolidin-5-yl]methoxy]phenyl]methyl]propanedioate.
| Compound Name | 3-O-tert-butyl 1-O-methyl 2-amino-2-[[4-[[3-[3-carbamimidoyl-4-[(2-methylpropan-2-yl)oxy]-4-oxo-3-piperidin-4-ylbutyl]-2-oxo-1,3-oxazolidin-5-yl]methoxy]phenyl]methyl]propanedioate |
|---|---|
| PubChem CID | 70029538 |
| Molecular Formula | C33H51N5O9 |
| Molecular Weight | 661.80 g/mol |
| Exact Mass | 661.37 |
| IUPAC Name | 3-O-tert-butyl 1-O-methyl 2-amino-2-[[4-[[3-[3-carbamimidoyl-4-[(2-methylpropan-2-yl)oxy]-4-oxo-3-piperidin-4-ylbutyl]-2-oxo-1,3-oxazolidin-5-yl]methoxy]phenyl]methyl]propanedioate |
| SMILES | [H]/N=C(\N)C(CCN1CC(COc2ccc(CC(N)(C(=O)OC)C(=O)OC(C)(C)C)cc2)OC1=O)(C(=O)OC(C)(C)C)C1CCNCC1 |
| InChI | InChI=1S/C33H51N5O9/c1-30(2,3)46-26(39)32(25(34)35,22-12-15-37-16-13-22)14-17-38-19-24(45-29(38)42)20-44-23-10-8-21(9-11-23)18-33(36,27(40)43-7)28(41)47-31(4,5)6/h8-11,22,24,37H,12-20,36H2,1-7H3,(H3,34,35) |
| InChIKey | MCFIFOCLCUPCCZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 205.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.80 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|