C30H38N2O4Si — CID 70031160
N-[6-amino-3-[tert-butyl(dimethyl)silyl]oxy-2-(4-methoxybenzoyl)phenyl]-4-propylbenzamide (PubChem CID 70031160) has the molecular formula C30H38N2O4Si and a molecular weight of 518.73 g/mol. Its IUPAC name is N-[6-amino-3-[tert-butyl(dimethyl)silyl]oxy-2-(4-methoxybenzoyl)phenyl]-4-propylbenzamide.
| Compound Name | N-[6-amino-3-[tert-butyl(dimethyl)silyl]oxy-2-(4-methoxybenzoyl)phenyl]-4-propylbenzamide |
|---|---|
| PubChem CID | 70031160 |
| Molecular Formula | C30H38N2O4Si |
| Molecular Weight | 518.73 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | N-[6-amino-3-[tert-butyl(dimethyl)silyl]oxy-2-(4-methoxybenzoyl)phenyl]-4-propylbenzamide |
| SMILES | CCCc1ccc(C(=O)Nc2c(N)ccc(O[Si](C)(C)C(C)(C)C)c2C(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C30H38N2O4Si/c1-8-9-20-10-12-22(13-11-20)29(34)32-27-24(31)18-19-25(36-37(6,7)30(2,3)4)26(27)28(33)21-14-16-23(35-5)17-15-21/h10-19H,8-9,31H2,1-7H3,(H,32,34) |
| InChIKey | VUZYCZYSEWGTFP-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.73 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|