C25H40INO2 — CID 7003226
2-iodo-1-[(5R,8R,9R,10S,13S,14R,17S)-2',2',10,13-tetramethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,5'-1,3-oxazolidine]-3'-yl]ethanone (PubChem CID 7003226) has the molecular formula C25H40INO2 and a molecular weight of 513.50 g/mol. Its IUPAC name is 2-iodo-1-[(5R,8R,9R,10S,13S,14R,17S)-2',2',10,13-tetramethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,5'-1,3-oxazolidine]-3'-yl]ethanone.
| Compound Name | 2-iodo-1-[(5R,8R,9R,10S,13S,14R,17S)-2',2',10,13-tetramethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,5'-1,3-oxazolidine]-3'-yl]ethanone |
|---|---|
| PubChem CID | 7003226 |
| Molecular Formula | C25H40INO2 |
| Molecular Weight | 513.50 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | 2-iodo-1-[(5R,8R,9R,10S,13S,14R,17S)-2',2',10,13-tetramethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,5'-1,3-oxazolidine]-3'-yl]ethanone |
| SMILES | CC1(C)O[C@]2(CC[C@@H]3[C@@H]4CC[C@H]5CCCC[C@]5(C)[C@@H]4CC[C@@]32C)CN1C(=O)CI |
| InChI | InChI=1S/C25H40INO2/c1-22(2)27(21(28)15-26)16-25(29-22)14-11-20-18-9-8-17-7-5-6-12-23(17,3)19(18)10-13-24(20,25)4/h17-20H,5-16H2,1-4H3/t17-,18-,19-,20-,23+,24+,25-/m1/s1 |
| InChIKey | RWFLLQUFBKGYBI-AONLGMNESA-N |
| XLogP | 6.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.50 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|