C31H41ClN2O7 — CID 70033771
methyl (2R)-2-[[2-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]amino]-4-methylpentanoate (PubChem CID 70033771) has the molecular formula C31H41ClN2O7 and a molecular weight of 589.13 g/mol. Its IUPAC name is methyl (2R)-2-[[2-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]amino]-4-methylpentanoate.
| Compound Name | methyl (2R)-2-[[2-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 70033771 |
| Molecular Formula | C31H41ClN2O7 |
| Molecular Weight | 589.13 g/mol |
| Exact Mass | 588.26 |
| IUPAC Name | methyl (2R)-2-[[2-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@@H](CC(C)C)NC(=O)C[C@H]1O[C@H](c2cccc(OC)c2OC)c2cc(Cl)ccc2N(CC(C)(C)C)C1=O |
| InChI | InChI=1S/C31H41ClN2O7/c1-18(2)14-22(30(37)40-8)33-26(35)16-25-29(36)34(17-31(3,4)5)23-13-12-19(32)15-21(23)27(41-25)20-10-9-11-24(38-6)28(20)39-7/h9-13,15,18,22,25,27H,14,16-17H2,1-8H3,(H,33,35)/t22-,25-,27-/m1/s1 |
| InChIKey | HFEQTLSAGUPXHZ-AVPJRLCVSA-N |
| XLogP | 5.32 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.13 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |