C23H24N3O5S2- — CID 70034612
2-[[4-carboxy-4-[4-(4-methoxyphenyl)-N-sulfinatoanilino]piperidin-1-yl]methyl]-1,3-thiazole (PubChem CID 70034612) has the molecular formula C23H24N3O5S2- and a molecular weight of 486.60 g/mol. Its IUPAC name is 2-[[4-carboxy-4-[4-(4-methoxyphenyl)-N-sulfinatoanilino]piperidin-1-yl]methyl]-1,3-thiazole.
| Compound Name | 2-[[4-carboxy-4-[4-(4-methoxyphenyl)-N-sulfinatoanilino]piperidin-1-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 70034612 |
| Molecular Formula | C23H24N3O5S2- |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | 2-[[4-carboxy-4-[4-(4-methoxyphenyl)-N-sulfinatoanilino]piperidin-1-yl]methyl]-1,3-thiazole |
| SMILES | COc1ccc(-c2ccc(N(S(=O)[O-])C3(C(=O)O)CCN(Cc4nccs4)CC3)cc2)cc1 |
| InChI | InChI=1S/C23H25N3O5S2/c1-31-20-8-4-18(5-9-20)17-2-6-19(7-3-17)26(33(29)30)23(22(27)28)10-13-25(14-11-23)16-21-24-12-15-32-21/h2-9,12,15H,10-11,13-14,16H2,1H3,(H,27,28)(H,29,30)/p-1 |
| InChIKey | VVPPMUDKAZUPLH-UHFFFAOYSA-M |
| XLogP | 3.54 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|