C19H21N2O5S- — CID 70035038
4-carboxy-4-[4-(4-methoxyphenyl)-N-sulfinatoanilino]piperidine (PubChem CID 70035038) has the molecular formula C19H21N2O5S- and a molecular weight of 389.45 g/mol. Its IUPAC name is 4-carboxy-4-[4-(4-methoxyphenyl)-N-sulfinatoanilino]piperidine.
| Compound Name | 4-carboxy-4-[4-(4-methoxyphenyl)-N-sulfinatoanilino]piperidine |
|---|---|
| PubChem CID | 70035038 |
| Molecular Formula | C19H21N2O5S- |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 4-carboxy-4-[4-(4-methoxyphenyl)-N-sulfinatoanilino]piperidine |
| SMILES | COc1ccc(-c2ccc(N(S(=O)[O-])C3(C(=O)O)CCNCC3)cc2)cc1 |
| InChI | InChI=1S/C19H22N2O5S/c1-26-17-8-4-15(5-9-17)14-2-6-16(7-3-14)21(27(24)25)19(18(22)23)10-12-20-13-11-19/h2-9,20H,10-13H2,1H3,(H,22,23)(H,24,25)/p-1 |
| InChIKey | IBTHWJJTJZJKOG-UHFFFAOYSA-M |
| XLogP | 2.17 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|