C22H31NO5 — CID 70034624
tert-butyl 4-benzyl-5-[(E)-4-methoxy-4-oxobut-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 70034624) has the molecular formula C22H31NO5 and a molecular weight of 389.49 g/mol. Its IUPAC name is tert-butyl 4-benzyl-5-[(E)-4-methoxy-4-oxobut-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl 4-benzyl-5-[(E)-4-methoxy-4-oxobut-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 70034624 |
| Molecular Formula | C22H31NO5 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | tert-butyl 4-benzyl-5-[(E)-4-methoxy-4-oxobut-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | COC(=O)/C=C/CC1OC(C)(C)N(C(=O)OC(C)(C)C)C1Cc1ccccc1 |
| InChI | InChI=1S/C22H31NO5/c1-21(2,3)28-20(25)23-17(15-16-11-8-7-9-12-16)18(27-22(23,4)5)13-10-14-19(24)26-6/h7-12,14,17-18H,13,15H2,1-6H3/b14-10+ |
| InChIKey | JUOFXJSIXXWWHO-GXDHUFHOSA-N |
| XLogP | 4.09 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|