C38H45ClN2O10 — CID 70036481
methyl 4-[3-[[2-[(3R,5S)-1-(3-acetyloxy-2,2-dimethylpropyl)-7-chloro-5-(2,3-dimethoxyphenyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]amino]-4-methoxyphenyl]butanoate (PubChem CID 70036481) has the molecular formula C38H45ClN2O10 and a molecular weight of 725.23 g/mol. Its IUPAC name is methyl 4-[3-[[2-[(3R,5S)-1-(3-acetyloxy-2,2-dimethylpropyl)-7-chloro-5-(2,3-dimethoxyphenyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]amino]-4-methoxyphenyl]butanoate.
| Compound Name | methyl 4-[3-[[2-[(3R,5S)-1-(3-acetyloxy-2,2-dimethylpropyl)-7-chloro-5-(2,3-dimethoxyphenyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]amino]-4-methoxyphenyl]butanoate |
|---|---|
| PubChem CID | 70036481 |
| Molecular Formula | C38H45ClN2O10 |
| Molecular Weight | 725.23 g/mol |
| Exact Mass | 724.28 |
| IUPAC Name | methyl 4-[3-[[2-[(3R,5S)-1-(3-acetyloxy-2,2-dimethylpropyl)-7-chloro-5-(2,3-dimethoxyphenyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]amino]-4-methoxyphenyl]butanoate |
| SMILES | COC(=O)CCCc1ccc(OC)c(NC(=O)C[C@H]2O[C@H](c3cccc(OC)c3OC)c3cc(Cl)ccc3N(CC(C)(C)COC(C)=O)C2=O)c1 |
| InChI | InChI=1S/C38H45ClN2O10/c1-23(42)50-22-38(2,3)21-41-29-16-15-25(39)19-27(29)35(26-11-9-12-31(47-5)36(26)49-7)51-32(37(41)45)20-33(43)40-28-18-24(14-17-30(28)46-4)10-8-13-34(44)48-6/h9,11-12,14-19,32,35H,8,10,13,20-22H2,1-7H3,(H,40,43)/t32-,35-/m1/s1 |
| InChIKey | ITUNDJPPVHVHJK-FHPVIJFVSA-N |
| XLogP | 6.30 |
| TPSA | 138.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.23 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |