C40H49ClN2O10 — CID 70036577
ethyl 5-[3-[[2-[(3R,5S)-1-(3-acetyloxy-2,2-dimethylpropyl)-7-chloro-5-(2,3-dimethoxyphenyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]amino]-4-methoxyphenyl]pentanoate (PubChem CID 70036577) has the molecular formula C40H49ClN2O10 and a molecular weight of 753.29 g/mol. Its IUPAC name is ethyl 5-[3-[[2-[(3R,5S)-1-(3-acetyloxy-2,2-dimethylpropyl)-7-chloro-5-(2,3-dimethoxyphenyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]amino]-4-methoxyphenyl]pentanoate.
| Compound Name | ethyl 5-[3-[[2-[(3R,5S)-1-(3-acetyloxy-2,2-dimethylpropyl)-7-chloro-5-(2,3-dimethoxyphenyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]amino]-4-methoxyphenyl]pentanoate |
|---|---|
| PubChem CID | 70036577 |
| Molecular Formula | C40H49ClN2O10 |
| Molecular Weight | 753.29 g/mol |
| Exact Mass | 752.31 |
| IUPAC Name | ethyl 5-[3-[[2-[(3R,5S)-1-(3-acetyloxy-2,2-dimethylpropyl)-7-chloro-5-(2,3-dimethoxyphenyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetyl]amino]-4-methoxyphenyl]pentanoate |
| SMILES | CCOC(=O)CCCCc1ccc(OC)c(NC(=O)C[C@H]2O[C@H](c3cccc(OC)c3OC)c3cc(Cl)ccc3N(CC(C)(C)COC(C)=O)C2=O)c1 |
| InChI | InChI=1S/C40H49ClN2O10/c1-8-51-36(46)15-10-9-12-26-16-19-32(48-5)30(20-26)42-35(45)22-34-39(47)43(23-40(3,4)24-52-25(2)44)31-18-17-27(41)21-29(31)37(53-34)28-13-11-14-33(49-6)38(28)50-7/h11,13-14,16-21,34,37H,8-10,12,15,22-24H2,1-7H3,(H,42,45)/t34-,37-/m1/s1 |
| InChIKey | TWJPGRBHHYMPSI-ZLHGTEGGSA-N |
| XLogP | 7.08 |
| TPSA | 138.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.29 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|