C6H12N+ — CID 7003736
(2S,5R)-2,5-dimethyl-2,5-dihydro-1H-pyrrol-1-ium (PubChem CID 7003736) has the molecular formula C6H12N+ and a molecular weight of 98.17 g/mol. Its IUPAC name is (2S,5R)-2,5-dimethyl-2,5-dihydro-1H-pyrrol-1-ium.
| Compound Name | (2S,5R)-2,5-dimethyl-2,5-dihydro-1H-pyrrol-1-ium |
|---|---|
| PubChem CID | 7003736 |
| Molecular Formula | C6H12N+ |
| Molecular Weight | 98.17 g/mol |
| Exact Mass | 98.10 |
| IUPAC Name | (2S,5R)-2,5-dimethyl-2,5-dihydro-1H-pyrrol-1-ium |
| SMILES | C[C@@H]1C=C[C@H](C)[NH2+]1 |
| InChI | InChI=1S/C6H11N/c1-5-3-4-6(2)7-5/h3-7H,1-2H3/p+1/t5-,6+ |
| InChIKey | TXQDHQBSNAJSHQ-OLQVQODUSA-O |
| XLogP | -0.10 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 98.17 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|