C25H20Cl3NO6 — CID 70039341
3-[5-(carboxymethyl)-2-chloroanilino]-2-[[4-[(2,6-dichlorophenyl)methoxy]phenyl]methyl]-3-oxopropanoic acid (PubChem CID 70039341) has the molecular formula C25H20Cl3NO6 and a molecular weight of 536.80 g/mol. Its IUPAC name is 3-[5-(carboxymethyl)-2-chloroanilino]-2-[[4-[(2,6-dichlorophenyl)methoxy]phenyl]methyl]-3-oxopropanoic acid.
| Compound Name | 3-[5-(carboxymethyl)-2-chloroanilino]-2-[[4-[(2,6-dichlorophenyl)methoxy]phenyl]methyl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 70039341 |
| Molecular Formula | C25H20Cl3NO6 |
| Molecular Weight | 536.80 g/mol |
| Exact Mass | 535.04 |
| IUPAC Name | 3-[5-(carboxymethyl)-2-chloroanilino]-2-[[4-[(2,6-dichlorophenyl)methoxy]phenyl]methyl]-3-oxopropanoic acid |
| SMILES | O=C(O)Cc1ccc(Cl)c(NC(=O)C(Cc2ccc(OCc3c(Cl)cccc3Cl)cc2)C(=O)O)c1 |
| InChI | InChI=1S/C25H20Cl3NO6/c26-19-2-1-3-20(27)18(19)13-35-16-7-4-14(5-8-16)10-17(25(33)34)24(32)29-22-11-15(12-23(30)31)6-9-21(22)28/h1-9,11,17H,10,12-13H2,(H,29,32)(H,30,31)(H,33,34) |
| InChIKey | CTLRFDQNQGPIMB-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.80 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|