C9H18N4O — CID 70039786
1-[(4-amino-3-methyl-1-propan-2-ylpyrazol-5-yl)amino]ethanol (PubChem CID 70039786) has the molecular formula C9H18N4O and a molecular weight of 198.27 g/mol. Its IUPAC name is 1-[(4-amino-3-methyl-1-propan-2-ylpyrazol-5-yl)amino]ethanol.
| Compound Name | 1-[(4-amino-3-methyl-1-propan-2-ylpyrazol-5-yl)amino]ethanol |
|---|---|
| PubChem CID | 70039786 |
| Molecular Formula | C9H18N4O |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | 1-[(4-amino-3-methyl-1-propan-2-ylpyrazol-5-yl)amino]ethanol |
| SMILES | Cc1nn(C(C)C)c(NC(C)O)c1N |
| InChI | InChI=1S/C9H18N4O/c1-5(2)13-9(11-7(4)14)8(10)6(3)12-13/h5,7,11,14H,10H2,1-4H3 |
| InChIKey | ONXIHFOVDNITEV-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|