C33H45NO9S — CID 70041614
tert-butyl (2S)-2-[[(2S)-2-[(2,3-diacetyloxycyclopentyl)sulfonylmethyl]-3-naphthalen-1-ylpropanoyl]amino]hexanoate (PubChem CID 70041614) has the molecular formula C33H45NO9S and a molecular weight of 631.79 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(2S)-2-[(2,3-diacetyloxycyclopentyl)sulfonylmethyl]-3-naphthalen-1-ylpropanoyl]amino]hexanoate.
| Compound Name | tert-butyl (2S)-2-[[(2S)-2-[(2,3-diacetyloxycyclopentyl)sulfonylmethyl]-3-naphthalen-1-ylpropanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 70041614 |
| Molecular Formula | C33H45NO9S |
| Molecular Weight | 631.79 g/mol |
| Exact Mass | 631.28 |
| IUPAC Name | tert-butyl (2S)-2-[[(2S)-2-[(2,3-diacetyloxycyclopentyl)sulfonylmethyl]-3-naphthalen-1-ylpropanoyl]amino]hexanoate |
| SMILES | CCCC[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)CS(=O)(=O)C1CCC(OC(C)=O)C1OC(C)=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H45NO9S/c1-7-8-16-27(32(38)43-33(4,5)6)34-31(37)25(19-24-14-11-13-23-12-9-10-15-26(23)24)20-44(39,40)29-18-17-28(41-21(2)35)30(29)42-22(3)36/h9-15,25,27-30H,7-8,16-20H2,1-6H3,(H,34,37)/t25-,27+,28?,29?,30?/m1/s1 |
| InChIKey | PYKPALZAUASLOX-GUKRNGDLSA-N |
| XLogP | 4.46 |
| TPSA | 142.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.79 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|