C22H27NO5 — CID 10091476
(2S)-2-[[(2R)-2-(acetyloxymethyl)-3-naphthalen-1-ylpropanoyl]amino]hexanoic acid (PubChem CID 10091476) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-(acetyloxymethyl)-3-naphthalen-1-ylpropanoyl]amino]hexanoic acid.
| Compound Name | (2S)-2-[[(2R)-2-(acetyloxymethyl)-3-naphthalen-1-ylpropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 10091476 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | (2S)-2-[[(2R)-2-(acetyloxymethyl)-3-naphthalen-1-ylpropanoyl]amino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)[C@@H](COC(C)=O)Cc1cccc2ccccc12)C(=O)O |
| InChI | InChI=1S/C22H27NO5/c1-3-4-12-20(22(26)27)23-21(25)18(14-28-15(2)24)13-17-10-7-9-16-8-5-6-11-19(16)17/h5-11,18,20H,3-4,12-14H2,1-2H3,(H,23,25)(H,26,27)/t18-,20+/m1/s1 |
| InChIKey | ZWOGRQGDLCYBGI-QUCCMNQESA-N |
| XLogP | 3.32 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |