C24H32ClN3O6 — CID 70042053
N-(1-azabicyclo[2.2.2]octan-3-yl)-4-butyl-6-chloro-2,3-dihydro-1,4-benzoxazine-8-carboxamide;but-2-enedioic acid (PubChem CID 70042053) has the molecular formula C24H32ClN3O6 and a molecular weight of 493.99 g/mol. Its IUPAC name is N-(1-azabicyclo[2.2.2]octan-3-yl)-4-butyl-6-chloro-2,3-dihydro-1,4-benzoxazine-8-carboxamide;but-2-enedioic acid.
| Compound Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-4-butyl-6-chloro-2,3-dihydro-1,4-benzoxazine-8-carboxamide;but-2-enedioic acid |
|---|---|
| PubChem CID | 70042053 |
| Molecular Formula | C24H32ClN3O6 |
| Molecular Weight | 493.99 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-4-butyl-6-chloro-2,3-dihydro-1,4-benzoxazine-8-carboxamide;but-2-enedioic acid |
| SMILES | CCCCN1CCOc2c(C(=O)NC3CN4CCC3CC4)cc(Cl)cc21.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C20H28ClN3O2.C4H4O4/c1-2-3-6-24-9-10-26-19-16(11-15(21)12-18(19)24)20(25)22-17-13-23-7-4-14(17)5-8-23;5-3(6)1-2-4(7)8/h11-12,14,17H,2-10,13H2,1H3,(H,22,25);1-2H,(H,5,6)(H,7,8) |
| InChIKey | KIAMJPGEZYUDPB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.99 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|