C17H13FN2O3 — CID 70042439
[2-(2,3-dihydroindol-1-yl)-7-fluoro-1,3-benzoxazol-6-yl] acetate (PubChem CID 70042439) has the molecular formula C17H13FN2O3 and a molecular weight of 312.30 g/mol. Its IUPAC name is [2-(2,3-dihydroindol-1-yl)-7-fluoro-1,3-benzoxazol-6-yl] acetate.
| Compound Name | [2-(2,3-dihydroindol-1-yl)-7-fluoro-1,3-benzoxazol-6-yl] acetate |
|---|---|
| PubChem CID | 70042439 |
| Molecular Formula | C17H13FN2O3 |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | [2-(2,3-dihydroindol-1-yl)-7-fluoro-1,3-benzoxazol-6-yl] acetate |
| SMILES | CC(=O)Oc1ccc2nc(N3CCc4ccccc43)oc2c1F |
| InChI | InChI=1S/C17H13FN2O3/c1-10(21)22-14-7-6-12-16(15(14)18)23-17(19-12)20-9-8-11-4-2-3-5-13(11)20/h2-7H,8-9H2,1H3 |
| InChIKey | JJFLGDCJDKKKPB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|