C27H44N4O5S2 — CID 70043915
(2S)-2-amino-4-methylsulfonyl-N-[(1R,2S,4S)-2,7,7-trimethyl-1-[[4-(2-methylphenyl)piperazin-1-yl]sulfonylmethyl]-2-bicyclo[2.2.1]heptanyl]butanamide (PubChem CID 70043915) has the molecular formula C27H44N4O5S2 and a molecular weight of 568.81 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfonyl-N-[(1R,2S,4S)-2,7,7-trimethyl-1-[[4-(2-methylphenyl)piperazin-1-yl]sulfonylmethyl]-2-bicyclo[2.2.1]heptanyl]butanamide.
| Compound Name | (2S)-2-amino-4-methylsulfonyl-N-[(1R,2S,4S)-2,7,7-trimethyl-1-[[4-(2-methylphenyl)piperazin-1-yl]sulfonylmethyl]-2-bicyclo[2.2.1]heptanyl]butanamide |
|---|---|
| PubChem CID | 70043915 |
| Molecular Formula | C27H44N4O5S2 |
| Molecular Weight | 568.81 g/mol |
| Exact Mass | 568.28 |
| IUPAC Name | (2S)-2-amino-4-methylsulfonyl-N-[(1R,2S,4S)-2,7,7-trimethyl-1-[[4-(2-methylphenyl)piperazin-1-yl]sulfonylmethyl]-2-bicyclo[2.2.1]heptanyl]butanamide |
| SMILES | Cc1ccccc1N1CCN(S(=O)(=O)C[C@@]23CC[C@@H](C[C@]2(C)NC(=O)[C@@H](N)CCS(C)(=O)=O)C3(C)C)CC1 |
| InChI | InChI=1S/C27H44N4O5S2/c1-20-8-6-7-9-23(20)30-13-15-31(16-14-30)38(35,36)19-27-12-10-21(25(27,2)3)18-26(27,4)29-24(32)22(28)11-17-37(5,33)34/h6-9,21-22H,10-19,28H2,1-5H3,(H,29,32)/t21-,22-,26-,27+/m0/s1 |
| InChIKey | GEFXMBLIDKULDK-RGXZNCPUSA-N |
| XLogP | 1.91 |
| TPSA | 129.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.81 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |