C28H28N2O4 — CID 23573630
4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-(2-methylphenyl)piperidine-4-carboxylic acid (PubChem CID 23573630) has the molecular formula C28H28N2O4 and a molecular weight of 456.54 g/mol. Its IUPAC name is 4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-(2-methylphenyl)piperidine-4-carboxylic acid.
| Compound Name | 4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-(2-methylphenyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 23573630 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-(2-methylphenyl)piperidine-4-carboxylic acid |
| SMILES | Cc1ccccc1N1CCC(NC(=O)OCC2c3ccccc3-c3ccccc32)(C(=O)O)CC1 |
| InChI | InChI=1S/C28H28N2O4/c1-19-8-2-7-13-25(19)30-16-14-28(15-17-30,26(31)32)29-27(33)34-18-24-22-11-5-3-9-20(22)21-10-4-6-12-23(21)24/h2-13,24H,14-18H2,1H3,(H,29,33)(H,31,32) |
| InChIKey | RGKSPVVVWRXCBS-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |