C27H25ClN2O4 — CID 22145281
1-(4-chlorophenyl)-4-(9H-fluoren-9-ylmethoxycarbonylamino)piperidine-4-carboxylic acid (PubChem CID 22145281) has the molecular formula C27H25ClN2O4 and a molecular weight of 476.96 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-(9H-fluoren-9-ylmethoxycarbonylamino)piperidine-4-carboxylic acid.
| Compound Name | 1-(4-chlorophenyl)-4-(9H-fluoren-9-ylmethoxycarbonylamino)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 22145281 |
| Molecular Formula | C27H25ClN2O4 |
| Molecular Weight | 476.96 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | 1-(4-chlorophenyl)-4-(9H-fluoren-9-ylmethoxycarbonylamino)piperidine-4-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)CCN(c2ccc(Cl)cc2)CC1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H25ClN2O4/c28-18-9-11-19(12-10-18)30-15-13-27(14-16-30,25(31)32)29-26(33)34-17-24-22-7-3-1-5-20(22)21-6-2-4-8-23(21)24/h1-12,24H,13-17H2,(H,29,33)(H,31,32) |
| InChIKey | GKHPKJKSSLLDLW-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.96 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |