C41H38N2O4 — CID 154730082
4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-[(4-methylphenyl)-diphenylmethyl]piperidine-4-carboxylic acid (PubChem CID 154730082) has the molecular formula C41H38N2O4 and a molecular weight of 622.77 g/mol. Its IUPAC name is 4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-[(4-methylphenyl)-diphenylmethyl]piperidine-4-carboxylic acid.
| Compound Name | 4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-[(4-methylphenyl)-diphenylmethyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 154730082 |
| Molecular Formula | C41H38N2O4 |
| Molecular Weight | 622.77 g/mol |
| Exact Mass | 622.28 |
| IUPAC Name | 4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-[(4-methylphenyl)-diphenylmethyl]piperidine-4-carboxylic acid |
| SMILES | Cc1ccc(C(c2ccccc2)(c2ccccc2)N2CCC(NC(=O)OCC3c4ccccc4-c4ccccc43)(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C41H38N2O4/c1-29-20-22-32(23-21-29)41(30-12-4-2-5-13-30,31-14-6-3-7-15-31)43-26-24-40(25-27-43,38(44)45)42-39(46)47-28-37-35-18-10-8-16-33(35)34-17-9-11-19-36(34)37/h2-23,37H,24-28H2,1H3,(H,42,46)(H,44,45) |
| InChIKey | PVVKXCKRJPMYAS-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.77 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|