C5H4Cl2N3O3- — CID 7004817
4-(carbamoylhydrazinylidene)-2,3-dichlorobut-2-enoate (PubChem CID 7004817) has the molecular formula C5H4Cl2N3O3- and a molecular weight of 225.01 g/mol. Its IUPAC name is 4-(carbamoylhydrazinylidene)-2,3-dichlorobut-2-enoate.
| Compound Name | 4-(carbamoylhydrazinylidene)-2,3-dichlorobut-2-enoate |
|---|---|
| PubChem CID | 7004817 |
| Molecular Formula | C5H4Cl2N3O3- |
| Molecular Weight | 225.01 g/mol |
| Exact Mass | 223.96 |
| IUPAC Name | 4-(carbamoylhydrazinylidene)-2,3-dichlorobut-2-enoate |
| SMILES | NC(=O)NN=CC(Cl)=C(Cl)C(=O)[O-] |
| InChI | InChI=1S/C5H5Cl2N3O3/c6-2(3(7)4(11)12)1-9-10-5(8)13/h1H,(H,11,12)(H3,8,10,13)/p-1 |
| InChIKey | VBMDQADZUXTSKC-UHFFFAOYSA-M |
| XLogP | -0.92 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.01 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|