C10H6Cl2N3O4- — CID 7164404
(E,4Z)-2,3-dichloro-4-[(4-nitrophenyl)hydrazinylidene]but-2-enoate (PubChem CID 7164404) has the molecular formula C10H6Cl2N3O4- and a molecular weight of 303.08 g/mol. Its IUPAC name is (E,4Z)-2,3-dichloro-4-[(4-nitrophenyl)hydrazinylidene]but-2-enoate.
| Compound Name | (E,4Z)-2,3-dichloro-4-[(4-nitrophenyl)hydrazinylidene]but-2-enoate |
|---|---|
| PubChem CID | 7164404 |
| Molecular Formula | C10H6Cl2N3O4- |
| Molecular Weight | 303.08 g/mol |
| Exact Mass | 301.97 |
| IUPAC Name | (E,4Z)-2,3-dichloro-4-[(4-nitrophenyl)hydrazinylidene]but-2-enoate |
| SMILES | O=C([O-])/C(Cl)=C(Cl)/C=N\Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H7Cl2N3O4/c11-8(9(12)10(16)17)5-13-14-6-1-3-7(4-2-6)15(18)19/h1-5,14H,(H,16,17)/p-1/b9-8+,13-5- |
| InChIKey | IPZTWAULIXCHDE-MUNAZHMESA-M |
| XLogP | 1.43 |
| TPSA | 107.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.08 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|