C10H7Cl2N3O4 — CID 2774696
(E)-2,3-dichloro-4-[(4-nitrophenyl)hydrazinylidene]but-2-enoic acid (PubChem CID 2774696) has the molecular formula C10H7Cl2N3O4 and a molecular weight of 304.09 g/mol. Its IUPAC name is (E)-2,3-dichloro-4-[(4-nitrophenyl)hydrazinylidene]but-2-enoic acid.
| Compound Name | (E)-2,3-dichloro-4-[(4-nitrophenyl)hydrazinylidene]but-2-enoic acid |
|---|---|
| PubChem CID | 2774696 |
| Molecular Formula | C10H7Cl2N3O4 |
| Molecular Weight | 304.09 g/mol |
| Exact Mass | 302.98 |
| IUPAC Name | (E)-2,3-dichloro-4-[(4-nitrophenyl)hydrazinylidene]but-2-enoic acid |
| SMILES | O=C(O)/C(Cl)=C(\Cl)C=NNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H7Cl2N3O4/c11-8(9(12)10(16)17)5-13-14-6-1-3-7(4-2-6)15(18)19/h1-5,14H,(H,16,17)/b9-8+,13-5? |
| InChIKey | IPZTWAULIXCHDE-HGNWCEHTSA-N |
| XLogP | 2.77 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.09 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|