C27H43N5O10S2 — CID 70049482
2-[[[(2S)-6-amino-2-(methanesulfonamido)hexanoyl]amino]methyl]-3-[1-[[(1S)-1-carboxy-2-[3-(methanesulfonamido)phenyl]ethyl]carbamoyl]cyclopentyl]propanoic acid (PubChem CID 70049482) has the molecular formula C27H43N5O10S2 and a molecular weight of 661.80 g/mol. Its IUPAC name is 2-[[[(2S)-6-amino-2-(methanesulfonamido)hexanoyl]amino]methyl]-3-[1-[[(1S)-1-carboxy-2-[3-(methanesulfonamido)phenyl]ethyl]carbamoyl]cyclopentyl]propanoic acid.
| Compound Name | 2-[[[(2S)-6-amino-2-(methanesulfonamido)hexanoyl]amino]methyl]-3-[1-[[(1S)-1-carboxy-2-[3-(methanesulfonamido)phenyl]ethyl]carbamoyl]cyclopentyl]propanoic acid |
|---|---|
| PubChem CID | 70049482 |
| Molecular Formula | C27H43N5O10S2 |
| Molecular Weight | 661.80 g/mol |
| Exact Mass | 661.25 |
| IUPAC Name | 2-[[[(2S)-6-amino-2-(methanesulfonamido)hexanoyl]amino]methyl]-3-[1-[[(1S)-1-carboxy-2-[3-(methanesulfonamido)phenyl]ethyl]carbamoyl]cyclopentyl]propanoic acid |
| SMILES | CS(=O)(=O)Nc1cccc(C[C@H](NC(=O)C2(CC(CNC(=O)[C@H](CCCCN)NS(C)(=O)=O)C(=O)O)CCCC2)C(=O)O)c1 |
| InChI | InChI=1S/C27H43N5O10S2/c1-43(39,40)31-20-9-7-8-18(14-20)15-22(25(36)37)30-26(38)27(11-4-5-12-27)16-19(24(34)35)17-29-23(33)21(10-3-6-13-28)32-44(2,41)42/h7-9,14,19,21-22,31-32H,3-6,10-13,15-17,28H2,1-2H3,(H,29,33)(H,30,38)(H,34,35)(H,36,37)/t19?,21-,22-/m0/s1 |
| InChIKey | HMUTVVQBUBJZRJ-GFUWAVFVSA-N |
| XLogP | -0.02 |
| TPSA | 251.16 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.80 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|