C29H27N3O — CID 70054163
N-[3-(2-aminoethyl)-5-naphthalen-1-ylindol-1-yl]-N-benzylacetamide (PubChem CID 70054163) has the molecular formula C29H27N3O and a molecular weight of 433.56 g/mol. Its IUPAC name is N-[3-(2-aminoethyl)-5-naphthalen-1-ylindol-1-yl]-N-benzylacetamide.
| Compound Name | N-[3-(2-aminoethyl)-5-naphthalen-1-ylindol-1-yl]-N-benzylacetamide |
|---|---|
| PubChem CID | 70054163 |
| Molecular Formula | C29H27N3O |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | N-[3-(2-aminoethyl)-5-naphthalen-1-ylindol-1-yl]-N-benzylacetamide |
| SMILES | CC(=O)N(Cc1ccccc1)n1cc(CCN)c2cc(-c3cccc4ccccc34)ccc21 |
| InChI | InChI=1S/C29H27N3O/c1-21(33)31(19-22-8-3-2-4-9-22)32-20-25(16-17-30)28-18-24(14-15-29(28)32)27-13-7-11-23-10-5-6-12-26(23)27/h2-15,18,20H,16-17,19,30H2,1H3 |
| InChIKey | JTCDWLLHISDZPA-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |