C20H24N3O3S+ — CID 7005428
4-methoxy-N-[3-(4-methylpiperazin-4-ium-1-yl)-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 7005428) has the molecular formula C20H24N3O3S+ and a molecular weight of 386.50 g/mol. Its IUPAC name is 4-methoxy-N-[3-(4-methylpiperazin-4-ium-1-yl)-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | 4-methoxy-N-[3-(4-methylpiperazin-4-ium-1-yl)-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 7005428 |
| Molecular Formula | C20H24N3O3S+ |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 4-methoxy-N-[3-(4-methylpiperazin-4-ium-1-yl)-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(C(=O)NC(=Cc2cccs2)C(=O)N2CC[NH+](C)CC2)cc1 |
| InChI | InChI=1S/C20H23N3O3S/c1-22-9-11-23(12-10-22)20(25)18(14-17-4-3-13-27-17)21-19(24)15-5-7-16(26-2)8-6-15/h3-8,13-14H,9-12H2,1-2H3,(H,21,24)/p+1 |
| InChIKey | UXGGKEDHHUXXSI-UHFFFAOYSA-O |
| XLogP | 0.88 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|