C28H22N2O3S — CID 70054414
2-[1-(benzenesulfonyl)-5-dibenzofuran-4-ylindol-3-yl]ethanamine (PubChem CID 70054414) has the molecular formula C28H22N2O3S and a molecular weight of 466.56 g/mol. Its IUPAC name is 2-[1-(benzenesulfonyl)-5-dibenzofuran-4-ylindol-3-yl]ethanamine.
| Compound Name | 2-[1-(benzenesulfonyl)-5-dibenzofuran-4-ylindol-3-yl]ethanamine |
|---|---|
| PubChem CID | 70054414 |
| Molecular Formula | C28H22N2O3S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 2-[1-(benzenesulfonyl)-5-dibenzofuran-4-ylindol-3-yl]ethanamine |
| SMILES | NCCc1cn(S(=O)(=O)c2ccccc2)c2ccc(-c3cccc4c3oc3ccccc34)cc12 |
| InChI | InChI=1S/C28H22N2O3S/c29-16-15-20-18-30(34(31,32)21-7-2-1-3-8-21)26-14-13-19(17-25(20)26)22-10-6-11-24-23-9-4-5-12-27(23)33-28(22)24/h1-14,17-18H,15-16,29H2 |
| InChIKey | BBNVFZRLLQFKTF-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 78.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |