C26H25BrN2O — CID 70054968
1-[[4-(2,2-diphenylethoxy)phenyl]methyl]pyridin-1-ium-4-amine bromide (PubChem CID 70054968) has the molecular formula C26H25BrN2O and a molecular weight of 461.40 g/mol. Its IUPAC name is 1-[[4-(2,2-diphenylethoxy)phenyl]methyl]pyridin-1-ium-4-amine bromide.
| Compound Name | 1-[[4-(2,2-diphenylethoxy)phenyl]methyl]pyridin-1-ium-4-amine bromide |
|---|---|
| PubChem CID | 70054968 |
| Molecular Formula | C26H25BrN2O |
| Molecular Weight | 461.40 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 1-[[4-(2,2-diphenylethoxy)phenyl]methyl]pyridin-1-ium-4-amine bromide |
| SMILES | Nc1cc[n+](Cc2ccc(OCC(c3ccccc3)c3ccccc3)cc2)cc1.[Br-] |
| InChI | InChI=1S/C26H24N2O.BrH/c27-24-15-17-28(18-16-24)19-21-11-13-25(14-12-21)29-20-26(22-7-3-1-4-8-22)23-9-5-2-6-10-23;/h1-18,26-27H,19-20H2;1H |
| InChIKey | PFAXISIKMWYFID-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 39.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.40 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|