C23H23NO7S — CID 70055930
2-[(2-benzyl-4-methoxyphenyl)sulfonylamino]-3-(2-hydroxyethoxy)benzoic acid (PubChem CID 70055930) has the molecular formula C23H23NO7S and a molecular weight of 457.50 g/mol. Its IUPAC name is 2-[(2-benzyl-4-methoxyphenyl)sulfonylamino]-3-(2-hydroxyethoxy)benzoic acid.
| Compound Name | 2-[(2-benzyl-4-methoxyphenyl)sulfonylamino]-3-(2-hydroxyethoxy)benzoic acid |
|---|---|
| PubChem CID | 70055930 |
| Molecular Formula | C23H23NO7S |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 2-[(2-benzyl-4-methoxyphenyl)sulfonylamino]-3-(2-hydroxyethoxy)benzoic acid |
| SMILES | COc1ccc(S(=O)(=O)Nc2c(OCCO)cccc2C(=O)O)c(Cc2ccccc2)c1 |
| InChI | InChI=1S/C23H23NO7S/c1-30-18-10-11-21(17(15-18)14-16-6-3-2-4-7-16)32(28,29)24-22-19(23(26)27)8-5-9-20(22)31-13-12-25/h2-11,15,24-25H,12-14H2,1H3,(H,26,27) |
| InChIKey | PLBNIKCSPDQSHV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |