C30H37NO5S — CID 70055236
butyl 2-[(2-benzyl-4-butoxyphenyl)sulfonylamino]-3,5-dimethylbenzoate (PubChem CID 70055236) has the molecular formula C30H37NO5S and a molecular weight of 523.70 g/mol. Its IUPAC name is butyl 2-[(2-benzyl-4-butoxyphenyl)sulfonylamino]-3,5-dimethylbenzoate.
| Compound Name | butyl 2-[(2-benzyl-4-butoxyphenyl)sulfonylamino]-3,5-dimethylbenzoate |
|---|---|
| PubChem CID | 70055236 |
| Molecular Formula | C30H37NO5S |
| Molecular Weight | 523.70 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | butyl 2-[(2-benzyl-4-butoxyphenyl)sulfonylamino]-3,5-dimethylbenzoate |
| SMILES | CCCCOC(=O)c1cc(C)cc(C)c1NS(=O)(=O)c1ccc(OCCCC)cc1Cc1ccccc1 |
| InChI | InChI=1S/C30H37NO5S/c1-5-7-16-35-26-14-15-28(25(21-26)20-24-12-10-9-11-13-24)37(33,34)31-29-23(4)18-22(3)19-27(29)30(32)36-17-8-6-2/h9-15,18-19,21,31H,5-8,16-17,20H2,1-4H3 |
| InChIKey | RUAANVDLOZBCOS-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.70 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|