C39H48N4O9 — CID 70057550
tert-butyl 2-[3-[3-(4-methoxyphenyl)-2-(phenylmethoxycarbonylamino)propanoyl]-2-oxo-3-[3-(phenylmethoxycarbonylamino)propyl]piperazin-1-yl]acetate (PubChem CID 70057550) has the molecular formula C39H48N4O9 and a molecular weight of 716.83 g/mol. Its IUPAC name is tert-butyl 2-[3-[3-(4-methoxyphenyl)-2-(phenylmethoxycarbonylamino)propanoyl]-2-oxo-3-[3-(phenylmethoxycarbonylamino)propyl]piperazin-1-yl]acetate.
| Compound Name | tert-butyl 2-[3-[3-(4-methoxyphenyl)-2-(phenylmethoxycarbonylamino)propanoyl]-2-oxo-3-[3-(phenylmethoxycarbonylamino)propyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 70057550 |
| Molecular Formula | C39H48N4O9 |
| Molecular Weight | 716.83 g/mol |
| Exact Mass | 716.34 |
| IUPAC Name | tert-butyl 2-[3-[3-(4-methoxyphenyl)-2-(phenylmethoxycarbonylamino)propanoyl]-2-oxo-3-[3-(phenylmethoxycarbonylamino)propyl]piperazin-1-yl]acetate |
| SMILES | COc1ccc(CC(NC(=O)OCc2ccccc2)C(=O)C2(CCCNC(=O)OCc3ccccc3)NCCN(CC(=O)OC(C)(C)C)C2=O)cc1 |
| InChI | InChI=1S/C39H48N4O9/c1-38(2,3)52-33(44)25-43-23-22-41-39(35(43)46,20-11-21-40-36(47)50-26-29-12-7-5-8-13-29)34(45)32(24-28-16-18-31(49-4)19-17-28)42-37(48)51-27-30-14-9-6-10-15-30/h5-10,12-19,32,41H,11,20-27H2,1-4H3,(H,40,47)(H,42,48) |
| InChIKey | BXYMCZNLAAJJSH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 161.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.83 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|