C26H39N3O7 — CID 70051178
methyl 2-[2-[(2S)-2-(butylamino)-3-(4-hydroxyphenyl)propanoyl]-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 70051178) has the molecular formula C26H39N3O7 and a molecular weight of 505.61 g/mol. Its IUPAC name is methyl 2-[2-[(2S)-2-(butylamino)-3-(4-hydroxyphenyl)propanoyl]-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | methyl 2-[2-[(2S)-2-(butylamino)-3-(4-hydroxyphenyl)propanoyl]-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 70051178 |
| Molecular Formula | C26H39N3O7 |
| Molecular Weight | 505.61 g/mol |
| Exact Mass | 505.28 |
| IUPAC Name | methyl 2-[2-[(2S)-2-(butylamino)-3-(4-hydroxyphenyl)propanoyl]-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCN[C@@H](Cc1ccc(O)cc1)C(=O)C1(CC(=O)OC)NCCN(CC(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C26H39N3O7/c1-6-7-12-27-20(15-18-8-10-19(30)11-9-18)23(33)26(16-21(31)35-5)24(34)29(14-13-28-26)17-22(32)36-25(2,3)4/h8-11,20,27-28,30H,6-7,12-17H2,1-5H3/t20-,26?/m0/s1 |
| InChIKey | XPSIXWUFPJELNF-DQUNLGLBSA-N |
| XLogP | 1.34 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.61 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|