C20H15F3N2O2 — CID 70058588
[2-(6-carbamimidoylnaphthalen-2-yl)phenyl]methyl 2,2,2-trifluoroacetate (PubChem CID 70058588) has the molecular formula C20H15F3N2O2 and a molecular weight of 372.35 g/mol. Its IUPAC name is [2-(6-carbamimidoylnaphthalen-2-yl)phenyl]methyl 2,2,2-trifluoroacetate.
| Compound Name | [2-(6-carbamimidoylnaphthalen-2-yl)phenyl]methyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 70058588 |
| Molecular Formula | C20H15F3N2O2 |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | [2-(6-carbamimidoylnaphthalen-2-yl)phenyl]methyl 2,2,2-trifluoroacetate |
| SMILES | [H]/N=C(\N)c1ccc2cc(-c3ccccc3COC(=O)C(F)(F)F)ccc2c1 |
| InChI | InChI=1S/C20H15F3N2O2/c21-20(22,23)19(26)27-11-16-3-1-2-4-17(16)14-7-5-13-10-15(18(24)25)8-6-12(13)9-14/h1-10H,11H2,(H3,24,25) |
| InChIKey | KVLPQJVHTWWGPN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 76.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|