C21H26N4O2 — CID 70061302
2-[4-[4-(4-carbamimidoylphenyl)phenyl]-2,6-dimethylpiperazin-1-yl]acetic acid (PubChem CID 70061302) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is 2-[4-[4-(4-carbamimidoylphenyl)phenyl]-2,6-dimethylpiperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[4-(4-carbamimidoylphenyl)phenyl]-2,6-dimethylpiperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 70061302 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 2-[4-[4-(4-carbamimidoylphenyl)phenyl]-2,6-dimethylpiperazin-1-yl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(-c2ccc(N3CC(C)N(CC(=O)O)C(C)C3)cc2)cc1 |
| InChI | InChI=1S/C21H26N4O2/c1-14-11-24(12-15(2)25(14)13-20(26)27)19-9-7-17(8-10-19)16-3-5-18(6-4-16)21(22)23/h3-10,14-15H,11-13H2,1-2H3,(H3,22,23)(H,26,27) |
| InChIKey | SEFWGECVNSSUOU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|