C16H26N4O3 — CID 70065036
(3R)-3-amino-4-cyclohexyl-2-hydroxy-N-(3-imidazol-1-ylpropanoyl)butanamide (PubChem CID 70065036) has the molecular formula C16H26N4O3 and a molecular weight of 322.41 g/mol. Its IUPAC name is (3R)-3-amino-4-cyclohexyl-2-hydroxy-N-(3-imidazol-1-ylpropanoyl)butanamide.
| Compound Name | (3R)-3-amino-4-cyclohexyl-2-hydroxy-N-(3-imidazol-1-ylpropanoyl)butanamide |
|---|---|
| PubChem CID | 70065036 |
| Molecular Formula | C16H26N4O3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | (3R)-3-amino-4-cyclohexyl-2-hydroxy-N-(3-imidazol-1-ylpropanoyl)butanamide |
| SMILES | N[C@H](CC1CCCCC1)C(O)C(=O)NC(=O)CCn1ccnc1 |
| InChI | InChI=1S/C16H26N4O3/c17-13(10-12-4-2-1-3-5-12)15(22)16(23)19-14(21)6-8-20-9-7-18-11-20/h7,9,11-13,15,22H,1-6,8,10,17H2,(H,19,21,23)/t13-,15?/m1/s1 |
| InChIKey | MSKZWHCOICMVGR-AFYYWNPRSA-N |
| XLogP | 0.57 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |