C17H22N2O2S — CID 70065921
(3R)-3-amino-4-ethylsulfanyl-2-hydroxy-N-(naphthalen-1-ylmethyl)butanamide (PubChem CID 70065921) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is (3R)-3-amino-4-ethylsulfanyl-2-hydroxy-N-(naphthalen-1-ylmethyl)butanamide.
| Compound Name | (3R)-3-amino-4-ethylsulfanyl-2-hydroxy-N-(naphthalen-1-ylmethyl)butanamide |
|---|---|
| PubChem CID | 70065921 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | (3R)-3-amino-4-ethylsulfanyl-2-hydroxy-N-(naphthalen-1-ylmethyl)butanamide |
| SMILES | CCSC[C@H](N)C(O)C(=O)NCc1cccc2ccccc12 |
| InChI | InChI=1S/C17H22N2O2S/c1-2-22-11-15(18)16(20)17(21)19-10-13-8-5-7-12-6-3-4-9-14(12)13/h3-9,15-16,20H,2,10-11,18H2,1H3,(H,19,21)/t15-,16?/m0/s1 |
| InChIKey | DAIGTESGZMYSNZ-VYRBHSGPSA-N |
| XLogP | 1.90 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |