C25H19N5O4 — CID 70066901
(E)-N-[3-[3-[(3-nitro-2-pyridinyl)amino]phenyl]phenyl]-3-(2-oxo-1H-pyridin-4-yl)prop-2-enamide (PubChem CID 70066901) has the molecular formula C25H19N5O4 and a molecular weight of 453.46 g/mol. Its IUPAC name is (E)-N-[3-[3-[(3-nitro-2-pyridinyl)amino]phenyl]phenyl]-3-(2-oxo-1H-pyridin-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[3-[3-[(3-nitro-2-pyridinyl)amino]phenyl]phenyl]-3-(2-oxo-1H-pyridin-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 70066901 |
| Molecular Formula | C25H19N5O4 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | (E)-N-[3-[3-[(3-nitro-2-pyridinyl)amino]phenyl]phenyl]-3-(2-oxo-1H-pyridin-4-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cc[nH]c(=O)c1)Nc1cccc(-c2cccc(Nc3ncccc3[N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C25H19N5O4/c31-23(10-9-17-11-13-26-24(32)14-17)28-20-6-1-4-18(15-20)19-5-2-7-21(16-19)29-25-22(30(33)34)8-3-12-27-25/h1-16H,(H,26,32)(H,27,29)(H,28,31)/b10-9+ |
| InChIKey | SFDWPZPHZGTQAH-MDZDMXLPSA-N |
| XLogP | 4.74 |
| TPSA | 130.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|