C19H17N5O5 — CID 70067197
6-[1-(2-hydroxyethyl)-2-oxopyrrolidin-3-yl]-8-(3-nitrophenyl)pyrido[2,3-d]pyridazin-5-one (PubChem CID 70067197) has the molecular formula C19H17N5O5 and a molecular weight of 395.38 g/mol. Its IUPAC name is 6-[1-(2-hydroxyethyl)-2-oxopyrrolidin-3-yl]-8-(3-nitrophenyl)pyrido[2,3-d]pyridazin-5-one.
| Compound Name | 6-[1-(2-hydroxyethyl)-2-oxopyrrolidin-3-yl]-8-(3-nitrophenyl)pyrido[2,3-d]pyridazin-5-one |
|---|---|
| PubChem CID | 70067197 |
| Molecular Formula | C19H17N5O5 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 6-[1-(2-hydroxyethyl)-2-oxopyrrolidin-3-yl]-8-(3-nitrophenyl)pyrido[2,3-d]pyridazin-5-one |
| SMILES | O=C1C(n2nc(-c3cccc([N+](=O)[O-])c3)c3ncccc3c2=O)CCN1CCO |
| InChI | InChI=1S/C19H17N5O5/c25-10-9-22-8-6-15(19(22)27)23-18(26)14-5-2-7-20-17(14)16(21-23)12-3-1-4-13(11-12)24(28)29/h1-5,7,11,15,25H,6,8-10H2 |
| InChIKey | HLLSWNASGNVZJD-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 131.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|