About 3-[cyclopropyl-(5,5-dibenzyl-4-hydroxy-2-oxofuran-3-yl)methyl]benzamide
3-[cyclopropyl-(5,5-dibenzyl-4-hydroxy-2-oxofuran-3-yl)methyl]benzamide (PubChem CID 70068704) has the molecular formula C29H27NO4
and a molecular weight of 453.54 g/mol. Its IUPAC name is 3-[cyclopropyl-(5,5-dibenzyl-4-hydroxy-2-oxofuran-3-yl)methyl]benzamide.
Molecular Properties
| Compound Name | 3-[cyclopropyl-(5,5-dibenzyl-4-hydroxy-2-oxofuran-3-yl)methyl]benzamide |
| PubChem CID | 70068704 |
| Molecular Formula | C29H27NO4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 3-[cyclopropyl-(5,5-dibenzyl-4-hydroxy-2-oxofuran-3-yl)methyl]benzamide |
| SMILES | NC(=O)c1cccc(C(C2=C(O)C(Cc3ccccc3)(Cc3ccccc3)OC2=O)C2CC2)c1 |
| InChI | InChI=1S/C29H27NO4/c30-27(32)23-13-7-12-22(16-23)24(21-14-15-21)25-26(31)29(34-28(25)33,17-19-8-3-1-4-9-19)18-20-10-5-2-6-11-20/h1-13,16,21,24,31H,14-15,17-18H2,(H2,30,32) |
| InChIKey | RQSIRZFLGSXECX-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[cyclopropyl-(5,5-dibenzyl-4-hydroxy-2-oxofuran-3-yl)methyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[cyclopropyl-(5,5-dibenzyl-4-hydroxy-2-oxofuran-3-yl)methyl]benzamide?
The IUPAC name of 3-[cyclopropyl-(5,5-dibenzyl-4-hydroxy-2-oxofuran-3-yl)methyl]benzamide (CID 70068704) is 3-[cyclopropyl-(5,5-dibenzyl-4-hydroxy-2-oxofuran-3-yl)methyl]benzamide.
What is the SMILES notation for 3-[cyclopropyl-(5,5-dibenzyl-4-hydroxy-2-oxofuran-3-yl)methyl]benzamide?
The canonical SMILES for 3-[cyclopropyl-(5,5-dibenzyl-4-hydroxy-2-oxofuran-3-yl)methyl]benzamide is NC(=O)c1cccc(C(C2=C(O)C(Cc3ccccc3)(Cc3ccccc3)OC2=O)C2CC2)c1.
What is the InChIKey of 3-[cyclopropyl-(5,5-dibenzyl-4-hydroxy-2-oxofuran-3-yl)methyl]benzamide?
The InChIKey is RQSIRZFLGSXECX-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H27NO4/c30-27(32)23-13-7-12-22(16-23)24(21-14-15-21)25-26(31)29(34-28(25)33,17-19-8-3-1-4-9-19)18-20-10-5-2-6-11-20/h1-13,16,21,24,31H,14-15,17-18H2,(H2,30,32).
What are the key properties of 3-[cyclopropyl-(5,5-dibenzyl-4-hydroxy-2-oxofuran-3-yl)methyl]benzamide?
3-[cyclopropyl-(5,5-dibenzyl-4-hydroxy-2-oxofuran-3-yl)methyl]benzamide has a molecular weight of 453.54 g/mol, XLogP of 4.87, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[cyclopropyl-(5,5-dibenzyl-4-hydroxy-2-oxofuran-3-yl)methyl]benzamide is sourced from PubChem (CID 70068704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).