C29H27NO4 — CID 54091043
3-[cyclopropyl-(5,5-dibenzyl-2,4-dioxooxolan-3-yl)methyl]benzamide (PubChem CID 54091043) has the molecular formula C29H27NO4 and a molecular weight of 453.54 g/mol. Its IUPAC name is 3-[cyclopropyl-(5,5-dibenzyl-2,4-dioxooxolan-3-yl)methyl]benzamide.
| Compound Name | 3-[cyclopropyl-(5,5-dibenzyl-2,4-dioxooxolan-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 54091043 |
| Molecular Formula | C29H27NO4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 3-[cyclopropyl-(5,5-dibenzyl-2,4-dioxooxolan-3-yl)methyl]benzamide |
| SMILES | NC(=O)c1cccc(C(C2CC2)C2C(=O)OC(Cc3ccccc3)(Cc3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C29H27NO4/c30-27(32)23-13-7-12-22(16-23)24(21-14-15-21)25-26(31)29(34-28(25)33,17-19-8-3-1-4-9-19)18-20-10-5-2-6-11-20/h1-13,16,21,24-25H,14-15,17-18H2,(H2,30,32) |
| InChIKey | MTWJMTQSTQUSGN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|