C35H36N2O5S — CID 54241809
N-[3-[1-(5,5-dibenzyl-2,4-dioxooxolan-3-yl)-2,2-dimethylpropyl]phenyl]-N-methylpyridine-2-sulfonamide (PubChem CID 54241809) has the molecular formula C35H36N2O5S and a molecular weight of 596.75 g/mol. Its IUPAC name is N-[3-[1-(5,5-dibenzyl-2,4-dioxooxolan-3-yl)-2,2-dimethylpropyl]phenyl]-N-methylpyridine-2-sulfonamide.
| Compound Name | N-[3-[1-(5,5-dibenzyl-2,4-dioxooxolan-3-yl)-2,2-dimethylpropyl]phenyl]-N-methylpyridine-2-sulfonamide |
|---|---|
| PubChem CID | 54241809 |
| Molecular Formula | C35H36N2O5S |
| Molecular Weight | 596.75 g/mol |
| Exact Mass | 596.23 |
| IUPAC Name | N-[3-[1-(5,5-dibenzyl-2,4-dioxooxolan-3-yl)-2,2-dimethylpropyl]phenyl]-N-methylpyridine-2-sulfonamide |
| SMILES | CN(c1cccc(C(C2C(=O)OC(Cc3ccccc3)(Cc3ccccc3)C2=O)C(C)(C)C)c1)S(=O)(=O)c1ccccn1 |
| InChI | InChI=1S/C35H36N2O5S/c1-34(2,3)31(27-18-13-19-28(22-27)37(4)43(40,41)29-20-11-12-21-36-29)30-32(38)35(42-33(30)39,23-25-14-7-5-8-15-25)24-26-16-9-6-10-17-26/h5-22,30-31H,23-24H2,1-4H3 |
| InChIKey | QQNYSNSOMGTYMB-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.75 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|