C40H40N2O5S — CID 54003084
N-[3-[1-[2,4-dioxo-6,6-bis(2-phenylethyl)oxan-3-yl]propyl]phenyl]-N-methylquinoline-2-sulfonamide (PubChem CID 54003084) has the molecular formula C40H40N2O5S and a molecular weight of 660.84 g/mol. Its IUPAC name is N-[3-[1-[2,4-dioxo-6,6-bis(2-phenylethyl)oxan-3-yl]propyl]phenyl]-N-methylquinoline-2-sulfonamide.
| Compound Name | N-[3-[1-[2,4-dioxo-6,6-bis(2-phenylethyl)oxan-3-yl]propyl]phenyl]-N-methylquinoline-2-sulfonamide |
|---|---|
| PubChem CID | 54003084 |
| Molecular Formula | C40H40N2O5S |
| Molecular Weight | 660.84 g/mol |
| Exact Mass | 660.27 |
| IUPAC Name | N-[3-[1-[2,4-dioxo-6,6-bis(2-phenylethyl)oxan-3-yl]propyl]phenyl]-N-methylquinoline-2-sulfonamide |
| SMILES | CCC(c1cccc(N(C)S(=O)(=O)c2ccc3ccccc3n2)c1)C1C(=O)CC(CCc2ccccc2)(CCc2ccccc2)OC1=O |
| InChI | InChI=1S/C40H40N2O5S/c1-3-34(32-18-12-19-33(27-32)42(2)48(45,46)37-22-21-31-17-10-11-20-35(31)41-37)38-36(43)28-40(47-39(38)44,25-23-29-13-6-4-7-14-29)26-24-30-15-8-5-9-16-30/h4-22,27,34,38H,3,23-26,28H2,1-2H3 |
| InChIKey | KMYZEBCNIUMLGA-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.84 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|