C28H33N3O5S — CID 54061499
N-[3-[cyclopropyl-(2,4-dioxo-5,5-dipropyloxolan-3-yl)methyl]phenyl]-N-methyl-1H-benzimidazole-2-sulfonamide (PubChem CID 54061499) has the molecular formula C28H33N3O5S and a molecular weight of 523.66 g/mol. Its IUPAC name is N-[3-[cyclopropyl-(2,4-dioxo-5,5-dipropyloxolan-3-yl)methyl]phenyl]-N-methyl-1H-benzimidazole-2-sulfonamide.
| Compound Name | N-[3-[cyclopropyl-(2,4-dioxo-5,5-dipropyloxolan-3-yl)methyl]phenyl]-N-methyl-1H-benzimidazole-2-sulfonamide |
|---|---|
| PubChem CID | 54061499 |
| Molecular Formula | C28H33N3O5S |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | N-[3-[cyclopropyl-(2,4-dioxo-5,5-dipropyloxolan-3-yl)methyl]phenyl]-N-methyl-1H-benzimidazole-2-sulfonamide |
| SMILES | CCCC1(CCC)OC(=O)C(C(c2cccc(N(C)S(=O)(=O)c3nc4ccccc4[nH]3)c2)C2CC2)C1=O |
| InChI | InChI=1S/C28H33N3O5S/c1-4-15-28(16-5-2)25(32)24(26(33)36-28)23(18-13-14-18)19-9-8-10-20(17-19)31(3)37(34,35)27-29-21-11-6-7-12-22(21)30-27/h6-12,17-18,23-24H,4-5,13-16H2,1-3H3,(H,29,30) |
| InChIKey | MAAZZBVPYXGSOF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 109.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|