C29H36N2O5S — CID 54240732
3-[1-[3-(1H-benzimidazol-2-ylsulfonylmethyl)phenyl]-2,2-dimethylpropyl]-5,5-dipropyloxolane-2,4-dione (PubChem CID 54240732) has the molecular formula C29H36N2O5S and a molecular weight of 524.68 g/mol. Its IUPAC name is 3-[1-[3-(1H-benzimidazol-2-ylsulfonylmethyl)phenyl]-2,2-dimethylpropyl]-5,5-dipropyloxolane-2,4-dione.
| Compound Name | 3-[1-[3-(1H-benzimidazol-2-ylsulfonylmethyl)phenyl]-2,2-dimethylpropyl]-5,5-dipropyloxolane-2,4-dione |
|---|---|
| PubChem CID | 54240732 |
| Molecular Formula | C29H36N2O5S |
| Molecular Weight | 524.68 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | 3-[1-[3-(1H-benzimidazol-2-ylsulfonylmethyl)phenyl]-2,2-dimethylpropyl]-5,5-dipropyloxolane-2,4-dione |
| SMILES | CCCC1(CCC)OC(=O)C(C(c2cccc(CS(=O)(=O)c3nc4ccccc4[nH]3)c2)C(C)(C)C)C1=O |
| InChI | InChI=1S/C29H36N2O5S/c1-6-15-29(16-7-2)25(32)23(26(33)36-29)24(28(3,4)5)20-12-10-11-19(17-20)18-37(34,35)27-30-21-13-8-9-14-22(21)31-27/h8-14,17,23-24H,6-7,15-16,18H2,1-5H3,(H,30,31) |
| InChIKey | QPUPTBNJPMJMLR-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.68 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|