C36H41N3O5S — CID 57277440
N-[3-[1-[2,4-dioxo-6,6-bis(2-phenylethyl)oxan-3-yl]-2,2-dimethylpropyl]phenyl]-1-methylimidazole-4-sulfonamide (PubChem CID 57277440) has the molecular formula C36H41N3O5S and a molecular weight of 627.81 g/mol. Its IUPAC name is N-[3-[1-[2,4-dioxo-6,6-bis(2-phenylethyl)oxan-3-yl]-2,2-dimethylpropyl]phenyl]-1-methylimidazole-4-sulfonamide.
| Compound Name | N-[3-[1-[2,4-dioxo-6,6-bis(2-phenylethyl)oxan-3-yl]-2,2-dimethylpropyl]phenyl]-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 57277440 |
| Molecular Formula | C36H41N3O5S |
| Molecular Weight | 627.81 g/mol |
| Exact Mass | 627.28 |
| IUPAC Name | N-[3-[1-[2,4-dioxo-6,6-bis(2-phenylethyl)oxan-3-yl]-2,2-dimethylpropyl]phenyl]-1-methylimidazole-4-sulfonamide |
| SMILES | Cn1cnc(S(=O)(=O)Nc2cccc(C(C3C(=O)CC(CCc4ccccc4)(CCc4ccccc4)OC3=O)C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C36H41N3O5S/c1-35(2,3)33(28-16-11-17-29(22-28)38-45(42,43)31-24-39(4)25-37-31)32-30(40)23-36(44-34(32)41,20-18-26-12-7-5-8-13-26)21-19-27-14-9-6-10-15-27/h5-17,22,24-25,32-33,38H,18-21,23H2,1-4H3 |
| InChIKey | VYYCERGXBNZOFC-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.81 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|