C29H34N2O5S — CID 54573580
N-[3-[1-(2,4-dioxo-6,6-dipropyloxan-3-yl)propyl]phenyl]quinoline-8-sulfonamide (PubChem CID 54573580) has the molecular formula C29H34N2O5S and a molecular weight of 522.67 g/mol. Its IUPAC name is N-[3-[1-(2,4-dioxo-6,6-dipropyloxan-3-yl)propyl]phenyl]quinoline-8-sulfonamide.
| Compound Name | N-[3-[1-(2,4-dioxo-6,6-dipropyloxan-3-yl)propyl]phenyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 54573580 |
| Molecular Formula | C29H34N2O5S |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | N-[3-[1-(2,4-dioxo-6,6-dipropyloxan-3-yl)propyl]phenyl]quinoline-8-sulfonamide |
| SMILES | CCCC1(CCC)CC(=O)C(C(CC)c2cccc(NS(=O)(=O)c3cccc4cccnc34)c2)C(=O)O1 |
| InChI | InChI=1S/C29H34N2O5S/c1-4-15-29(16-5-2)19-24(32)26(28(33)36-29)23(6-3)21-11-7-13-22(18-21)31-37(34,35)25-14-8-10-20-12-9-17-30-27(20)25/h7-14,17-18,23,26,31H,4-6,15-16,19H2,1-3H3 |
| InChIKey | ZZADSJNSOJAGMZ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|