C28H41N3O5S — CID 90760311
N-[3-[1-[6,6-bis(2-methylpropyl)-2,4-dioxooxan-3-yl]-2,2-dimethylpropyl]phenyl]-1-methylimidazole-4-sulfonamide (PubChem CID 90760311) has the molecular formula C28H41N3O5S and a molecular weight of 531.72 g/mol. Its IUPAC name is N-[3-[1-[6,6-bis(2-methylpropyl)-2,4-dioxooxan-3-yl]-2,2-dimethylpropyl]phenyl]-1-methylimidazole-4-sulfonamide.
| Compound Name | N-[3-[1-[6,6-bis(2-methylpropyl)-2,4-dioxooxan-3-yl]-2,2-dimethylpropyl]phenyl]-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 90760311 |
| Molecular Formula | C28H41N3O5S |
| Molecular Weight | 531.72 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | N-[3-[1-[6,6-bis(2-methylpropyl)-2,4-dioxooxan-3-yl]-2,2-dimethylpropyl]phenyl]-1-methylimidazole-4-sulfonamide |
| SMILES | CC(C)CC1(CC(C)C)CC(=O)C(C(c2cccc(NS(=O)(=O)c3cn(C)cn3)c2)C(C)(C)C)C(=O)O1 |
| InChI | InChI=1S/C28H41N3O5S/c1-18(2)13-28(14-19(3)4)15-22(32)24(26(33)36-28)25(27(5,6)7)20-10-9-11-21(12-20)30-37(34,35)23-16-31(8)17-29-23/h9-12,16-19,24-25,30H,13-15H2,1-8H3 |
| InChIKey | NSRUIBSJLKFHSD-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.72 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|